CAS 1217500-86-1 appears in our catalog under these names: 2-Benzyloxypyrimidine-5-boronic acid, 96%, (2-(Benzyloxy)pyrimidin-5-yl)boronic acid, 98%, 2–Benzyloxypyrimidine–5–boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
(2-phenylmethoxypyrimidin-5-yl)boronic acid (CAS 1217500-86-1) is a chemical compound with the molecular formula C11H11BN2O3 and a molecular weight of 230.03 g/mol. IUPAC name: (2-phenylmethoxypyrimidin-5-yl)boronic acid. InChIKey: CYHDQODLSLRGRH-UHFFFAOYSA-N.
| Molecular formula | C11H11BN2O3 |
|---|---|
| Molecular weight | 230.03 g/mol |
| IUPAC name | (2-phenylmethoxypyrimidin-5-yl)boronic acid |
| InChIKey | CYHDQODLSLRGRH-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)