CAS 1704081-88-8 is the registry number for (4–(1H–Pyrrole–1–carboxamido)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[4-(pyrrole-1-carbonylamino)phenyl]boronic acid (CAS 1704081-88-8) is a chemical compound with the molecular formula C11H11BN2O3 and a molecular weight of 230.03 g/mol. IUPAC name: [4-(pyrrole-1-carbonylamino)phenyl]boronic acid. InChIKey: OAXHZXUYYNQAQT-UHFFFAOYSA-N.
| Molecular formula | C11H11BN2O3 |
|---|---|
| Molecular weight | 230.03 g/mol |
| IUPAC name | [4-(pyrrole-1-carbonylamino)phenyl]boronic acid |
| InChIKey | OAXHZXUYYNQAQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)N2C=CC=C2)(O)O |
Computed by PubChem (NCBI)