CAS 2857815-67-7 is the registry number for (2-Cyclopropyl-4-oxo-1,4-dihydroquinazolin-7-yl)boronic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-cyclopropyl-4-oxo-3H-quinazolin-7-yl)boronic acid (CAS 2857815-67-7) is a chemical compound with the molecular formula C11H11BN2O3 and a molecular weight of 230.03 g/mol. IUPAC name: (2-cyclopropyl-4-oxo-3H-quinazolin-7-yl)boronic acid. InChIKey: KBKBLAMKESEMSF-UHFFFAOYSA-N.
| Molecular formula | C11H11BN2O3 |
|---|---|
| Molecular weight | 230.03 g/mol |
| IUPAC name | (2-cyclopropyl-4-oxo-3H-quinazolin-7-yl)boronic acid |
| InChIKey | KBKBLAMKESEMSF-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=O)NC(=N2)C3CC3)(O)O |
Computed by PubChem (NCBI)