CAS 2225154-84-5 is the registry number for (2–(3–methoxyphenyl)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[2-(3-methoxyphenyl)pyrimidin-5-yl]boronic acid (CAS 2225154-84-5) is a chemical compound with the molecular formula C11H11BN2O3 and a molecular weight of 230.03 g/mol. IUPAC name: [2-(3-methoxyphenyl)pyrimidin-5-yl]boronic acid. InChIKey: GLJQHPIZYAYVAC-UHFFFAOYSA-N.
| Molecular formula | C11H11BN2O3 |
|---|---|
| Molecular weight | 230.03 g/mol |
| IUPAC name | [2-(3-methoxyphenyl)pyrimidin-5-yl]boronic acid |
| InChIKey | GLJQHPIZYAYVAC-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)C2=CC(=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)