Products 1217500-97-4

CAS 1217500-97-4 appears in our catalog under these names: 4-(Isobutylthio)phenylboronic acid, 98%, (4-(Isobutylthio)phenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

[4-(2-methylpropylsulfanyl)phenyl]boronic acid (CAS 1217500-97-4) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: [4-(2-methylpropylsulfanyl)phenyl]boronic acid. InChIKey: ROAGXTNYXGUULT-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BO2S
Molecular weight210.11 g/mol
IUPAC name[4-(2-methylpropylsulfanyl)phenyl]boronic acid
InChIKeyROAGXTNYXGUULT-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)SCC(C)C)(O)O

Computed by PubChem (NCBI)