CAS 1217500-97-4 appears in our catalog under these names: 4-(Isobutylthio)phenylboronic acid, 98%, (4-(Isobutylthio)phenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
[4-(2-methylpropylsulfanyl)phenyl]boronic acid (CAS 1217500-97-4) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: [4-(2-methylpropylsulfanyl)phenyl]boronic acid. InChIKey: ROAGXTNYXGUULT-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2S |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | [4-(2-methylpropylsulfanyl)phenyl]boronic acid |
| InChIKey | ROAGXTNYXGUULT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SCC(C)C)(O)O |
Computed by PubChem (NCBI)