Products 1217500-97-4
CAS 1217500-97-4 is the registry number for 4-(Isobutylthio)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.
[4-(2-methylpropylsulfanyl)phenyl]boronic acid (CAS 1217500-97-4) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: [4-(2-methylpropylsulfanyl)phenyl]boronic acid. InChIKey: ROAGXTNYXGUULT-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2S |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | [4-(2-methylpropylsulfanyl)phenyl]boronic acid |
| InChIKey | ROAGXTNYXGUULT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SCC(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(Isobutylthio)phenylboronic acid, (4-(Isobutylthio)phenyl)boronic acid, [4-(2-methylpropylsulfanyl)phenyl]boronic acid, Boronic acid, B-[4-[(2-methylpropyl)thio]phenyl]-, {4-[(2-Methylpropyl)sulfanyl]phenyl}boronic acid, (4-(Isobutylthio)phenyl)boronicacid, (4-isobutylsulfanylphenyl)boronic acid