CAS 1352304-52-9 is the registry number for 5,5–dimethyl–2–(5–methylthiophen–2–yl)–1,3,2–dioxaborinane. Offered by: GLPBio. Available pack sizes: 1g, 25g, 5g.
5,5-dimethyl-2-(5-methylthiophen-2-yl)-1,3,2-dioxaborinane (CAS 1352304-52-9) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: 5,5-dimethyl-2-(5-methylthiophen-2-yl)-1,3,2-dioxaborinane. InChIKey: UKQPJMLZQVGZLX-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2S |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | 5,5-dimethyl-2-(5-methylthiophen-2-yl)-1,3,2-dioxaborinane |
| InChIKey | UKQPJMLZQVGZLX-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(S2)C |
Computed by PubChem (NCBI)