CAS 1217501-05-7 appears in our catalog under these names: 3-(t-Butylthio)phenylboronic acid, 98%, (3-(Tert-butylthio)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
(3-tert-butylsulfanylphenyl)boronic acid (CAS 1217501-05-7) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: (3-tert-butylsulfanylphenyl)boronic acid. InChIKey: WARYEXGCYYRRPN-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2S |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | (3-tert-butylsulfanylphenyl)boronic acid |
| InChIKey | WARYEXGCYYRRPN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)SC(C)(C)C)(O)O |
Computed by PubChem (NCBI)