Products 820972-68-7
CAS 820972-68-7 appears in our catalog under these names: 4-(tert-Butylthio)phenylboronic Acid, 4–(tert–Butylthio)phenylboronic acid, (4-(tert-Butylthio)phenyl)boronic acid 98%, 4-(tert-Butylthio)phenylboronic acid, 98%, 98%. Offered by: TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 500mg, 100mg, 1g, 250mg, 5g, 25g.
(4-tert-butylsulfanylphenyl)boronic acid (CAS 820972-68-7) is a chemical compound with the molecular formula C10H15BO2S and a molecular weight of 210.11 g/mol. IUPAC name: (4-tert-butylsulfanylphenyl)boronic acid. InChIKey: RLSGPRQEFFGNKS-UHFFFAOYSA-N.
| Molecular formula | C10H15BO2S |
|---|---|
| Molecular weight | 210.11 g/mol |
| IUPAC name | (4-tert-butylsulfanylphenyl)boronic acid |
| InChIKey | RLSGPRQEFFGNKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SC(C)(C)C)(O)O |
Computed by PubChem (NCBI)