CAS 1217621-81-2 is the registry number for D-(-)-Lactic acid-13C-2 (sodium). Offered by: MedChemExpress. Available pack sizes: 1 mg.
Sodium (2R)-2-hydroxy(313C)propanoate (CAS 1217621-81-2) is a chemical compound with the molecular formula C3H5NaO3 and a molecular weight of 113.05 g/mol. IUPAC name: sodium (2R)-2-hydroxy(313C)propanoate. InChIKey: NGSFWBMYFKHRBD-MDBPNCOTSA-M.
| Molecular formula | C3H5NaO3 |
|---|---|
| Molecular weight | 113.05 g/mol |
| IUPAC name | sodium (2R)-2-hydroxy(313C)propanoate |
| InChIKey | NGSFWBMYFKHRBD-MDBPNCOTSA-M |
| SMILES | [13CH3][C@H](C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)