Products 1217644-84-2
CAS 1217644-84-2 appears in our catalog under these names: Zolmitriptan-d6, Zolmitriptan-D6 (Major). Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5 mg.
(4S)-4-[[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one (CAS 1217644-84-2) is a chemical compound with the molecular formula C16H21N3O2 and a molecular weight of 293.39 g/mol. IUPAC name: (4S)-4-[[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one. InChIKey: ULSDMUVEXKOYBU-MYLWHKILSA-N.
| Molecular formula | C16H21N3O2 |
|---|---|
| Molecular weight | 293.39 g/mol |
| IUPAC name | (4S)-4-[[3-[2-[bis(trideuteriomethyl)amino]ethyl]-1H-indol-5-yl]methyl]-1,3-oxazolidin-2-one |
| InChIKey | ULSDMUVEXKOYBU-MYLWHKILSA-N |
| SMILES | [2H]C([2H])([2H])N(CCC1=CNC2=C1C=C(C=C2)C[C@H]3COC(=O)N3)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)