Products 1217648-75-3
CAS 1217648-75-3 appears in our catalog under these names: Nortilidine-d3 Hydrochloride, Nortilidine-d3 Hydrochloride (100μg/ml in Methanol). Offered by: TRC. Available pack sizes: 10mg, 1mg, 1x1ml.
Ethyl (1R,2R)-1-phenyl-2-(trideuteriomethylamino)cyclohex-3-ene-1-carboxylate;hydrochloride (CAS 1217648-75-3) is a chemical compound with the molecular formula C16H22ClNO2 and a molecular weight of 298.82 g/mol. IUPAC name: ethyl (1R,2R)-1-phenyl-2-(trideuteriomethylamino)cyclohex-3-ene-1-carboxylate;hydrochloride. InChIKey: REPHWVDUMWCCKC-VTWXJATBSA-N.
| Molecular formula | C16H22ClNO2 |
|---|---|
| Molecular weight | 298.82 g/mol |
| IUPAC name | ethyl (1R,2R)-1-phenyl-2-(trideuteriomethylamino)cyclohex-3-ene-1-carboxylate;hydrochloride |
| InChIKey | REPHWVDUMWCCKC-VTWXJATBSA-N |
| SMILES | [2H]C([2H])([2H])N[C@@H]1C=CCC[C@]1(C2=CC=CC=C2)C(=O)OCC.Cl |
Computed by PubChem (NCBI)
Synonyms:
Nortilidine-d3 Hydrochloride