CAS 1217675-92-7 is the registry number for (S)-Benzyl 2-(hydroxymethyl)piperazine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Benzyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate (CAS 1217675-92-7) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: benzyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: DUSWOUMCIHZHBH-LBPRGKRZSA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | benzyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | DUSWOUMCIHZHBH-LBPRGKRZSA-N |
| SMILES | C1CN([C@@H](CN1)CO)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)