Products 250681-69-7

CAS 250681-69-7 is the registry number for 1-Boc-4-(3-carboxy-phenoxy)-piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxybenzoic acid (CAS 250681-69-7) is a chemical compound with the molecular formula C17H23NO5 and a molecular weight of 321.4 g/mol. IUPAC name: 3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxybenzoic acid. InChIKey: GUHLCCZKORFGQB-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23NO5
Molecular weight321.4 g/mol
IUPAC name3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]oxybenzoic acid
InChIKeyGUHLCCZKORFGQB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)OC2=CC=CC(=C2)C(=O)O

Computed by PubChem (NCBI)