Products 1217703-95-1
CAS 1217703-95-1 appears in our catalog under these names: ent Atomoxetine-d3, Hydrochloride, >95% (HPLC), Ent atomoxetine-d3, hydrochloride, (S)-Tomoxetine-d3 (hydrochloride). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg, 10 mg.
(3S)-3-(2-methylphenoxy)-3-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1217703-95-1) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 294.8 g/mol. IUPAC name: (3S)-3-(2-methylphenoxy)-3-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: LUCXVPAZUDVVBT-GJILKALXSA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | (3S)-3-(2-methylphenoxy)-3-phenyl-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | LUCXVPAZUDVVBT-GJILKALXSA-N |
| SMILES | [2H]C([2H])([2H])NCC[C@@H](C1=CC=CC=C1)OC2=CC=CC=C2C.Cl |
Computed by PubChem (NCBI)