Products 1398065-95-6
CAS 1398065-95-6 appears in our catalog under these names: rac Atomoxetine-d5 Hydrochloride, >95% (HPLC), (±)-Atomoxetine-d5 HCl (phenyl-d5), 98 atom % D, min 98% Chemical Purity, (Rac)–Atomoxetine–d5 hydrochloride, (Rac)-Atomoxetine-d5 (hydrochloride), 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
N-methyl-3-(2-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)propan-1-amine;hydrochloride (CAS 1398065-95-6) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 296.8 g/mol. IUPAC name: N-methyl-3-(2-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)propan-1-amine;hydrochloride. InChIKey: LUCXVPAZUDVVBT-JMWQIYKASA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 296.8 g/mol |
| IUPAC name | N-methyl-3-(2-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)propan-1-amine;hydrochloride |
| InChIKey | LUCXVPAZUDVVBT-JMWQIYKASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CCNC)OC2=CC=CC=C2C)[2H])[2H].Cl |
Computed by PubChem (NCBI)