CAS 82857-39-4 appears in our catalog under these names: Atomoxetine EP Impurity B HCl ((S)-Atomoxetine HCl), Atomoxetine Impurity 2(Atomoxetine EP Impurity B), S-(+)-Atomoxetine Hydrochloride, >95% (HPLC), (3S)–N–methyl–3–(2–methylphenoxy)–3–phenylpropan–1–amine,hydrochloride, ent S-(+)-atomoxetine hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 500mg.
(3S)-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride (CAS 82857-39-4) is a chemical compound with the molecular formula C17H22ClNO and a molecular weight of 291.8 g/mol. IUPAC name: (3S)-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride. InChIKey: LUCXVPAZUDVVBT-LMOVPXPDSA-N.
| Molecular formula | C17H22ClNO |
|---|---|
| Molecular weight | 291.8 g/mol |
| IUPAC name | (3S)-N-methyl-3-(2-methylphenoxy)-3-phenylpropan-1-amine;hydrochloride |
| InChIKey | LUCXVPAZUDVVBT-LMOVPXPDSA-N |
| SMILES | CC1=CC=CC=C1O[C@@H](CCNC)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)