Products 1217704-83-0
CAS 1217704-83-0 appears in our catalog under these names: Benzyl (S)-2-(hydroxymethyl)piperazine-1-carboxylate hydrochloride, 95%, Benzyl (S)-2-(hydroxymethyl)piperazine-1-carboxylate hydrochloride, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Benzyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride (CAS 1217704-83-0) is a chemical compound with the molecular formula C13H19ClN2O3 and a molecular weight of 286.75 g/mol. IUPAC name: benzyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride. InChIKey: QZXGMZXWHWGKHR-YDALLXLXSA-N.
| Molecular formula | C13H19ClN2O3 |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | benzyl (2S)-2-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | QZXGMZXWHWGKHR-YDALLXLXSA-N |
| SMILES | C1CN([C@@H](CN1)CO)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)