CAS 1217775-18-2 appears in our catalog under these names: Benzyl (R)-2-(hydroxymethyl)piperazine-1-carboxylate hydrochloride, 97%, Benzyl (R)-2-(hydroxymethyl)piperazine-1-carboxylate (hydrochloride), 95%, benzyl (R)-2-(hydroxymethyl)piperazine-1-carboxylate hydrochloride, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 250mg, 5g, 25g, 1g, 100mg.
Benzyl (2R)-2-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride (CAS 1217775-18-2) is a chemical compound with the molecular formula C13H19ClN2O3 and a molecular weight of 286.75 g/mol. IUPAC name: benzyl (2R)-2-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride. InChIKey: QZXGMZXWHWGKHR-UTONKHPSSA-N.
| Molecular formula | C13H19ClN2O3 |
|---|---|
| Molecular weight | 286.75 g/mol |
| IUPAC name | benzyl (2R)-2-(hydroxymethyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | QZXGMZXWHWGKHR-UTONKHPSSA-N |
| SMILES | C1CN([C@H](CN1)CO)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)