CAS 1217723-39-1 is the registry number for ((3S,4R)-4-(3,5-Dimethoxyphenyl)pyrrolidin-3-yl)methanol hydrochloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3S,4R)-4-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methanol;hydrochloride (CAS 1217723-39-1) is a chemical compound with the molecular formula C13H20ClNO3 and a molecular weight of 273.75 g/mol. IUPAC name: [(3S,4R)-4-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methanol;hydrochloride. InChIKey: PLIAZUSZWIAYMM-VVBGOIRUSA-N.
| Molecular formula | C13H20ClNO3 |
|---|---|
| Molecular weight | 273.75 g/mol |
| IUPAC name | [(3S,4R)-4-(3,5-dimethoxyphenyl)pyrrolidin-3-yl]methanol;hydrochloride |
| InChIKey | PLIAZUSZWIAYMM-VVBGOIRUSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@@H]2CNC[C@H]2CO)OC.Cl |
Computed by PubChem (NCBI)