CAS 1217756-56-3 is the registry number for (S)-(2-Methyl-6-nitro-2,3-dihydroimidazo[2,1-b]oxazol-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methanol (CAS 1217756-56-3) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: [(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methanol. InChIKey: UYEAVRLFLZMBSY-ZETCQYMHSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | [(2S)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl]methanol |
| InChIKey | UYEAVRLFLZMBSY-ZETCQYMHSA-N |
| SMILES | C[C@]1(CN2C=C(N=C2O1)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)