CAS 1217819-16-3 is the registry number for rel-Methyl (2R,4R)-4-(4-methoxyphenoxy)pyrrolidine-2-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,4S)-4-(4-methoxyphenoxy)pyrrolidine-2-carboxylate;hydrochloride (CAS 1217819-16-3) is a chemical compound with the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. IUPAC name: methyl (2S,4S)-4-(4-methoxyphenoxy)pyrrolidine-2-carboxylate;hydrochloride. InChIKey: FKPMGLCFBFYQRI-FXMYHANSSA-N.
| Molecular formula | C13H18ClNO4 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | methyl (2S,4S)-4-(4-methoxyphenoxy)pyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | FKPMGLCFBFYQRI-FXMYHANSSA-N |
| SMILES | COC1=CC=C(C=C1)O[C@H]2C[C@H](NC2)C(=O)OC.Cl |
Computed by PubChem (NCBI)