Products 2230799-96-7

CAS 2230799-96-7 is the registry number for Ethyl 2-amino-5-(2-ethoxy-2-oxoethyl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-5-(2-ethoxy-2-oxoethyl)benzoate;hydrochloride (CAS 2230799-96-7) is a chemical compound with the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. IUPAC name: ethyl 2-amino-5-(2-ethoxy-2-oxoethyl)benzoate;hydrochloride. InChIKey: YYBCNAYIHODAQA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18ClNO4
Molecular weight287.74 g/mol
IUPAC nameethyl 2-amino-5-(2-ethoxy-2-oxoethyl)benzoate;hydrochloride
InChIKeyYYBCNAYIHODAQA-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CC(=C(C=C1)N)C(=O)OCC.Cl

Computed by PubChem (NCBI)