CAS 58952-79-7 appears in our catalog under these names: Phenylephrine Impurity 63 HCl, 3-Acetoxy-alpha-((methylamino)methyl)-(R)-benzenemethanol 1-Acetate Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[3-[(1R)-1-acetyloxy-2-(methylamino)ethyl]phenyl] acetate;hydrochloride (CAS 58952-79-7) is a chemical compound with the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. IUPAC name: [3-[(1R)-1-acetyloxy-2-(methylamino)ethyl]phenyl] acetate;hydrochloride. InChIKey: JSMUTRORLWWTKB-ZOWNYOTGSA-N.
| Molecular formula | C13H18ClNO4 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | [3-[(1R)-1-acetyloxy-2-(methylamino)ethyl]phenyl] acetate;hydrochloride |
| InChIKey | JSMUTRORLWWTKB-ZOWNYOTGSA-N |
| SMILES | CC(=O)OC1=CC=CC(=C1)[C@H](CNC)OC(=O)C.Cl |
Computed by PubChem (NCBI)