Products 1392210-72-8
CAS 1392210-72-8 appears in our catalog under these names: (3R,4S)-rel-4-(3,4-Dimethoxyphenyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%, 98%, (3S,4R)-4-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylic acid hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(3R,4S)-4-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1392210-72-8) is a chemical compound with the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. IUPAC name: (3R,4S)-4-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: NNHCYHNOCXLNDZ-UXQCFNEQSA-N.
| Molecular formula | C13H18ClNO4 |
|---|---|
| Molecular weight | 287.74 g/mol |
| IUPAC name | (3R,4S)-4-(3,4-dimethoxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | NNHCYHNOCXLNDZ-UXQCFNEQSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]2CNC[C@@H]2C(=O)O)OC.Cl |
Computed by PubChem (NCBI)