Products 1217850-83-3
CAS 1217850-83-3 is the registry number for (R)-tert-Butyl 3-(pyridin-2-ylthio)pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3R)-3-pyridin-2-ylsulfanylpyrrolidine-1-carboxylate (CAS 1217850-83-3) is a chemical compound with the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. IUPAC name: tert-butyl (3R)-3-pyridin-2-ylsulfanylpyrrolidine-1-carboxylate. InChIKey: DTBLJARRVUJNIE-LLVKDONJSA-N.
| Molecular formula | C14H20N2O2S |
|---|---|
| Molecular weight | 280.39 g/mol |
| IUPAC name | tert-butyl (3R)-3-pyridin-2-ylsulfanylpyrrolidine-1-carboxylate |
| InChIKey | DTBLJARRVUJNIE-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)SC2=CC=CC=N2 |
Computed by PubChem (NCBI)