CAS 83477-71-8 is the registry number for N'-Cyclopentylidene-2,4,6-trimethylbenzenesulfonohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
N-(cyclopentylideneamino)-2,4,6-trimethylbenzenesulfonamide (CAS 83477-71-8) is a chemical compound with the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. IUPAC name: N-(cyclopentylideneamino)-2,4,6-trimethylbenzenesulfonamide. InChIKey: NPLJOTIKSYABKT-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2S |
|---|---|
| Molecular weight | 280.39 g/mol |
| IUPAC name | N-(cyclopentylideneamino)-2,4,6-trimethylbenzenesulfonamide |
| InChIKey | NPLJOTIKSYABKT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NN=C2CCCC2)C |
Computed by PubChem (NCBI)