CAS 792953-97-0 appears in our catalog under these names: 1-(5,6,7,8-Tetrahydronaphthalene-2-sulfonyl)piperazine, 98%, 1-(5,6,7,8-Tetrahydronaphthalene-2-sulfonyl)piperazine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine (CAS 792953-97-0) is a chemical compound with the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. IUPAC name: 1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine. InChIKey: KPTUZGXRJRMKEI-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2S |
|---|---|
| Molecular weight | 280.39 g/mol |
| IUPAC name | 1-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazine |
| InChIKey | KPTUZGXRJRMKEI-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)S(=O)(=O)N3CCNCC3 |
Computed by PubChem (NCBI)