CAS 99281-95-5 appears in our catalog under these names: BOC-L-PHENYLALANINE THIOAMIDE, 95%, 95%, Boc-l-phenylalanine thioamide, 95%, tert–Butyl (S)–(1–Amino–3–phenyl–1–thioxopropan–2–yl)carbamate, tert-Butyl (S)-(1-Amino-3-phenyl-1-thioxopropan-2-yl)carbamate, 95%. Offered by: Chemat, Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 50mg, 5g.
Tert-butyl N-[(2S)-1-amino-3-phenyl-1-sulfanylidenepropan-2-yl]carbamate (CAS 99281-95-5) is a chemical compound with the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. IUPAC name: tert-butyl N-[(2S)-1-amino-3-phenyl-1-sulfanylidenepropan-2-yl]carbamate. InChIKey: NMNBNAKCWAWQSR-NSHDSACASA-N.
| Molecular formula | C14H20N2O2S |
|---|---|
| Molecular weight | 280.39 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-amino-3-phenyl-1-sulfanylidenepropan-2-yl]carbamate |
| InChIKey | NMNBNAKCWAWQSR-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=S)N |
Computed by PubChem (NCBI)