CAS 121831-04-7 is the registry number for 2-(9,10-Dioxo-9,10-dihydroanthracen-2-yl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(9,10-dioxoanthracen-2-yl)acetonitrile (CAS 121831-04-7) is a chemical compound with the molecular formula C16H9NO2 and a molecular weight of 247.25 g/mol. IUPAC name: 2-(9,10-dioxoanthracen-2-yl)acetonitrile. InChIKey: PDOFSHJOQBHGMM-UHFFFAOYSA-N.
| Molecular formula | C16H9NO2 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-(9,10-dioxoanthracen-2-yl)acetonitrile |
| InChIKey | PDOFSHJOQBHGMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)CC#N |
Computed by PubChem (NCBI)