Products 93487-20-8
CAS 93487-20-8 appears in our catalog under these names: 1-Nitropyrene-d9, >95% (HPLC), 1-Nitropyrene-d9, 98 atom % D, min 98% Chemical Purity, 1-Nitropyrene-d9. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 2,5mg, 0,05g, 0,01g, 1 mg.
1,2,3,4,5,6,7,9,10-nonadeuterio-8-nitropyrene (CAS 93487-20-8) is a chemical compound with the molecular formula C16H9NO2 and a molecular weight of 256.30 g/mol. IUPAC name: 1,2,3,4,5,6,7,9,10-nonadeuterio-8-nitropyrene. InChIKey: ALRLPDGCPYIVHP-LOIXRAQWSA-N.
| Molecular formula | C16H9NO2 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,9,10-nonadeuterio-8-nitropyrene |
| InChIKey | ALRLPDGCPYIVHP-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C2=C3C(=C1[2H])C(=C(C4=C(C(=C(C(=C43)C(=C2[2H])[2H])[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H] |
Computed by PubChem (NCBI)