Products 89447-90-5
CAS 89447-90-5 is the registry number for 4-(1,3-Dioxo-2,3-dihydro-1H-inden-2-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,3-dioxoinden-2-yl)benzonitrile (CAS 89447-90-5) is a chemical compound with the molecular formula C16H9NO2 and a molecular weight of 247.25 g/mol. IUPAC name: 4-(1,3-dioxoinden-2-yl)benzonitrile. InChIKey: WSRUAEWHXYSQRO-UHFFFAOYSA-N.
| Molecular formula | C16H9NO2 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 4-(1,3-dioxoinden-2-yl)benzonitrile |
| InChIKey | WSRUAEWHXYSQRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(C2=O)C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)