CAS 42086-68-0 appears in our catalog under these names: Olaparib Impurity 42, Olaparib Impurity W. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(E)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzonitrile (CAS 42086-68-0) is a chemical compound with the molecular formula C16H9NO2 and a molecular weight of 247.25 g/mol. IUPAC name: 3-[(E)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzonitrile. InChIKey: FCXMKELNVVARNC-OQLLNIDSSA-N.
| Molecular formula | C16H9NO2 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 3-[(E)-(3-oxo-2-benzofuran-1-ylidene)methyl]benzonitrile |
| InChIKey | FCXMKELNVVARNC-OQLLNIDSSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C\C3=CC(=CC=C3)C#N)/OC2=O |
Computed by PubChem (NCBI)