CAS 121859-57-2 appears in our catalog under these names: 5,6-Dichloroindole, 5,6-Dichloroindole, >98.0%(GC), 5,6-Dichloro-1H-indole, 98%, 98%, 5,6-Dichloroindole, 98%, 5,6-Dichloro-1H-indole, 98%. Offered by: Biosynth, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 50g, 25g, 1g, 5g, 100g, 250g, 500g, 10g.
5,6-dichloro-1H-indole (CAS 121859-57-2) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 5,6-dichloro-1H-indole. InChIKey: ILINOHVVKWYAFM-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 5,6-dichloro-1H-indole |
| InChIKey | ILINOHVVKWYAFM-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)