CAS 122509-73-3 appears in our catalog under these names: 4,5–Dichloroindole, 4,5-Dichloroindole, 4,5-Dichloroindole 95%, 4,5-Dichloroindole, 98%, 98%, 4,5-DICHLOROINDOLE, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g.
4,5-dichloro-1H-indole (CAS 122509-73-3) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 4,5-dichloro-1H-indole. InChIKey: MUWQPYPTCAUUGM-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 4,5-dichloro-1H-indole |
| InChIKey | MUWQPYPTCAUUGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NC=C2)Cl)Cl |
Computed by PubChem (NCBI)