CAS 1218594-32-1 is the registry number for 2-{(4-(Aminomethyl)phenyl)methanesulfonamido}propanamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[[4-(aminomethyl)phenyl]methylsulfonylamino]propanamide (CAS 1218594-32-1) is a chemical compound with the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. IUPAC name: 2-[[4-(aminomethyl)phenyl]methylsulfonylamino]propanamide. InChIKey: ZHYNINLADZDCFC-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O3S |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 2-[[4-(aminomethyl)phenyl]methylsulfonylamino]propanamide |
| InChIKey | ZHYNINLADZDCFC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N)NS(=O)(=O)CC1=CC=C(C=C1)CN |
Computed by PubChem (NCBI)