Products 1246820-50-7
CAS 1246820-50-7 appears in our catalog under these names: Carbutamide-D9, >95% (HPLC), Carbutamide-d9. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
1-(4-aminophenyl)sulfonyl-3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)urea (CAS 1246820-50-7) is a chemical compound with the molecular formula C11H17N3O3S and a molecular weight of 280.39 g/mol. IUPAC name: 1-(4-aminophenyl)sulfonyl-3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)urea. InChIKey: VDTNNGKXZGSZIP-WRMMWXQOSA-N.
| Molecular formula | C11H17N3O3S |
|---|---|
| Molecular weight | 280.39 g/mol |
| IUPAC name | 1-(4-aminophenyl)sulfonyl-3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)urea |
| InChIKey | VDTNNGKXZGSZIP-WRMMWXQOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])NC(=O)NS(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)