CAS 1803593-73-8 appears in our catalog under these names: 4-Amino-2-(ethylsulfamoyl)-N,N-dimethylbenzamide, 95%, 4-Amino-2-(ethylsulfamoyl)-N,N-dimethylbenzamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-amino-2-(ethylsulfamoyl)-N,N-dimethylbenzamide (CAS 1803593-73-8) is a chemical compound with the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. IUPAC name: 4-amino-2-(ethylsulfamoyl)-N,N-dimethylbenzamide. InChIKey: CTZLREPXTZLXNL-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O3S |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | 4-amino-2-(ethylsulfamoyl)-N,N-dimethylbenzamide |
| InChIKey | CTZLREPXTZLXNL-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=C(C=CC(=C1)N)C(=O)N(C)C |
Computed by PubChem (NCBI)