CAS 1427460-19-2 is the registry number for Methyl 4-amino-2-(2,6-dimethylmorpholin-4-yl)-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 4-amino-2-(2,6-dimethylmorpholin-4-yl)-1,3-thiazole-5-carboxylate (CAS 1427460-19-2) is a chemical compound with the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. IUPAC name: methyl 4-amino-2-(2,6-dimethylmorpholin-4-yl)-1,3-thiazole-5-carboxylate. InChIKey: FURVHBZCHKMODH-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O3S |
|---|---|
| Molecular weight | 271.34 g/mol |
| IUPAC name | methyl 4-amino-2-(2,6-dimethylmorpholin-4-yl)-1,3-thiazole-5-carboxylate |
| InChIKey | FURVHBZCHKMODH-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=NC(=C(S2)C(=O)OC)N |
Computed by PubChem (NCBI)