CAS 1219-46-1 appears in our catalog under these names: N-Epsilon-benzoyl-L-lysine, 98%, (S)-2-Amino-6-benzamidohexanoic acid 95%, N-epsilon-Benzoyl-L-lysine, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 250mg.
(2S)-2-amino-6-benzamidohexanoic acid (CAS 1219-46-1) is a chemical compound with the molecular formula C13H18N2O3 and a molecular weight of 250.29 g/mol. IUPAC name: (2S)-2-amino-6-benzamidohexanoic acid. InChIKey: KODLJWKGAKBGOB-NSHDSACASA-N.
| Molecular formula | C13H18N2O3 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | (2S)-2-amino-6-benzamidohexanoic acid |
| InChIKey | KODLJWKGAKBGOB-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)