CAS 121936-51-4 appears in our catalog under these names: 4-(tert-Butyldimethylsilyloxy) cyclohexanamine, 95%, 4-((tert-Butyldimethylsilyl)oxy)cyclohexanamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-amine (CAS 121936-51-4) is a chemical compound with the molecular formula C12H27NOSi and a molecular weight of 229.43 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-amine. InChIKey: ISXIKNULHMXZTR-UHFFFAOYSA-N.
| Molecular formula | C12H27NOSi |
|---|---|
| Molecular weight | 229.43 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-amine |
| InChIKey | ISXIKNULHMXZTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CC1)N |
Computed by PubChem (NCBI)