CAS 1534354-34-1 is the registry number for 2-(2-((tert-Butyldimethylsilyl)oxy)ethyl)-3-ethylaziridine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Tert-butyl-[2-(3-ethylaziridin-2-yl)ethoxy]-dimethylsilane (CAS 1534354-34-1) is a chemical compound with the molecular formula C12H27NOSi and a molecular weight of 229.43 g/mol. IUPAC name: tert-butyl-[2-(3-ethylaziridin-2-yl)ethoxy]-dimethylsilane. InChIKey: YELJXPORFJRBJY-UHFFFAOYSA-N.
| Molecular formula | C12H27NOSi |
|---|---|
| Molecular weight | 229.43 g/mol |
| IUPAC name | tert-butyl-[2-(3-ethylaziridin-2-yl)ethoxy]-dimethylsilane |
| InChIKey | YELJXPORFJRBJY-UHFFFAOYSA-N |
| SMILES | CCC1C(N1)CCO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)