CAS 2271478-54-5 is the registry number for Rel-(1R,3R)-3-((tert-butyldimethylsilyl)oxy)cyclohexan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-amine (CAS 2271478-54-5) is a chemical compound with the molecular formula C12H27NOSi and a molecular weight of 229.43 g/mol. IUPAC name: trans-(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-amine. InChIKey: UCCUEKPBIXIODS-GHMZBOCLSA-N.
| Molecular formula | C12H27NOSi |
|---|---|
| Molecular weight | 229.43 g/mol |
| IUPAC name | trans-(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-amine |
| InChIKey | UCCUEKPBIXIODS-GHMZBOCLSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@H](C1)N |
Computed by PubChem (NCBI)