CAS 2730887-87-1 is the registry number for Rel-(1s,3r)-3-((tert-butyldimethylsilyl)oxy)-3-ethylcyclobutan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclobutan-1-amine (CAS 2730887-87-1) is a chemical compound with the molecular formula C12H27NOSi and a molecular weight of 229.43 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclobutan-1-amine. InChIKey: NPVXLXOQPBTJLN-UHFFFAOYSA-N.
| Molecular formula | C12H27NOSi |
|---|---|
| Molecular weight | 229.43 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxy-3-ethylcyclobutan-1-amine |
| InChIKey | NPVXLXOQPBTJLN-UHFFFAOYSA-N |
| SMILES | CCC1(CC(C1)N)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)