Products 1219365-61-3
CAS 1219365-61-3 is the registry number for LpxC-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-but-2-ynoxybenzamide (CAS 1219365-61-3) is a chemical compound with the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. IUPAC name: N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-but-2-ynoxybenzamide. InChIKey: JPCUWLVKAJJSLN-CYBMUJFWSA-N.
| Molecular formula | C16H21N3O4 |
|---|---|
| Molecular weight | 319.36 g/mol |
| IUPAC name | N-[(2S)-3-amino-1-(hydroxyamino)-3-methyl-1-oxobutan-2-yl]-4-but-2-ynoxybenzamide |
| InChIKey | JPCUWLVKAJJSLN-CYBMUJFWSA-N |
| SMILES | CC#CCOC1=CC=C(C=C1)C(=O)N[C@H](C(=O)NO)C(C)(C)N |
Computed by PubChem (NCBI)
Synonyms:
LpxC Inhibitor C1(-), orb3136714