Products 1219373-19-9
CAS 1219373-19-9 is the registry number for (Rac)-2-Aminobutyric acid-d3. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
2-amino-4,4,4-trideuteriobutanoic acid (CAS 1219373-19-9) is a chemical compound with the molecular formula C4H9NO2 and a molecular weight of 106.14 g/mol. IUPAC name: 2-amino-4,4,4-trideuteriobutanoic acid. InChIKey: QWCKQJZIFLGMSD-FIBGUPNXSA-N.
| Molecular formula | C4H9NO2 |
|---|---|
| Molecular weight | 106.14 g/mol |
| IUPAC name | 2-amino-4,4,4-trideuteriobutanoic acid |
| InChIKey | QWCKQJZIFLGMSD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(C(=O)O)N |
Computed by PubChem (NCBI)