Products 1219485-46-7
CAS 1219485-46-7 is the registry number for 1-Isopropyltryptophan. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-amino-3-(1-propan-2-ylindol-3-yl)propanoic acid (CAS 1219485-46-7) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: (2S)-2-amino-3-(1-propan-2-ylindol-3-yl)propanoic acid. InChIKey: YAQRKENUISHWOB-LBPRGKRZSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (2S)-2-amino-3-(1-propan-2-ylindol-3-yl)propanoic acid |
| InChIKey | YAQRKENUISHWOB-LBPRGKRZSA-N |
| SMILES | CC(C)N1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)