Products 1219794-55-4
CAS 1219794-55-4 appears in our catalog under these names: 4-Octylphenol-d17, 4-n-Octyl-d17-phenol, >95% (HPLC), 4-n-Octyl-d17-phenol, 98 atom % D, min 98% Chemical Purity, D17-4-n-Octylphenol, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: MedChemExpress, TRC, CDN, HPC Standards. Available pack sizes: 10 mg, 2 mg, 1 mg, 10mg, 1mg, 2mg, 0,1g, 0,05g.
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)phenol (CAS 1219794-55-4) is a chemical compound with the molecular formula C14H22O and a molecular weight of 223.43 g/mol. IUPAC name: 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)phenol. InChIKey: NTDQQZYCCIDJRK-OISRNESJSA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 223.43 g/mol |
| IUPAC name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecadeuteriooctyl)phenol |
| InChIKey | NTDQQZYCCIDJRK-OISRNESJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)