CAS 1246815-03-1 is the registry number for 4-Octylphenol-d4. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
2,3,5,6-tetradeuterio-4-octylphenol (CAS 1246815-03-1) is a chemical compound with the molecular formula C14H22O and a molecular weight of 210.35 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-octylphenol. InChIKey: NTDQQZYCCIDJRK-IRYCTXJYSA-N.
| Molecular formula | C14H22O |
|---|---|
| Molecular weight | 210.35 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-octylphenol |
| InChIKey | NTDQQZYCCIDJRK-IRYCTXJYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CCCCCCCC)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)