Products 1246815-03-1

CAS 1246815-03-1 is the registry number for 4-Octylphenol-d4. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.

Structural formula: {0} (CAS {1})

2,3,5,6-tetradeuterio-4-octylphenol (CAS 1246815-03-1) is a chemical compound with the molecular formula C14H22O and a molecular weight of 210.35 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-octylphenol. InChIKey: NTDQQZYCCIDJRK-IRYCTXJYSA-N.

Identity
Molecular formulaC14H22O
Molecular weight210.35 g/mol
IUPAC name2,3,5,6-tetradeuterio-4-octylphenol
InChIKeyNTDQQZYCCIDJRK-IRYCTXJYSA-N
SMILES[2H]C1=C(C(=C(C(=C1CCCCCCCC)[2H])[2H])O)[2H]

Computed by PubChem (NCBI)

Synonyms: 4-Octylphenol-d4