Products 1219794-64-5
CAS 1219794-64-5 appears in our catalog under these names: 2,2',4,6,6'-Pentachlorobiphenyl-3',4',5'-d3, 98 atom % D, min 98% Chemical Purity, 2,2',4,6,6'-Pentachloro-1,1'-biphenyl-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1 mg.
1,5-dichloro-2,3,4-trideuterio-6-(2,4,6-trichlorophenyl)benzene (CAS 1219794-64-5) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 329.4 g/mol. IUPAC name: 1,5-dichloro-2,3,4-trideuterio-6-(2,4,6-trichlorophenyl)benzene. InChIKey: MTCPZNVSDFCBBE-CBYSEHNBSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 1,5-dichloro-2,3,4-trideuterio-6-(2,4,6-trichlorophenyl)benzene |
| InChIKey | MTCPZNVSDFCBBE-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Cl)C2=C(C=C(C=C2Cl)Cl)Cl)Cl)[2H] |
Computed by PubChem (NCBI)