Products 104130-39-4
CAS 104130-39-4 appears in our catalog under these names: PCB 101-13C12, >95% (HPLC), PCB No. 101 13C12 40 µg/mL in Isooctane, PCB 101-13C12, K 101-13C12. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, MedChemExpress. Available pack sizes: 0,5mg, 2,5mg, 5ml, 1ml, 1mg, 500 μg.
1,2,4-trichloro-5-(2,5-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 104130-39-4) is a chemical compound with the molecular formula C12H5Cl5 and a molecular weight of 338.3 g/mol. IUPAC name: 1,2,4-trichloro-5-(2,5-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: LAHWLEDBADHJGA-WCGVKTIYSA-N.
| Molecular formula | C12H5Cl5 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | 1,2,4-trichloro-5-(2,5-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | LAHWLEDBADHJGA-WCGVKTIYSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1Cl)[13C]2=[13CH][13C](=[13C]([13CH]=[13C]2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)